Difference between revisions of "Seminolipids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-714 == * common-name: ** cathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...")
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-714 ==
+
== Metabolite CPD-474 ==
 
* common-name:
 
* common-name:
** cathasterone
+
** (+)-taxifolin
 
* smiles:
 
* smiles:
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
 
* inchi-key:
 
* inchi-key:
** jsvpgvhceqdjcz-vgehdtswsa-n
+
** cxqwrcvtcmqvqx-lsdhhaiusa-m
 
* molecular-weight:
 
* molecular-weight:
** 432.685
+
** 303.248
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-527]]
 +
* [[RXN-600]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-715]]
+
* [[RXN-7775]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cathasterone}}
+
{{#set: common-name=(+)-taxifolin}}
{{#set: inchi-key=inchikey=jsvpgvhceqdjcz-vgehdtswsa-n}}
+
{{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}}
{{#set: molecular-weight=432.685}}
+
{{#set: molecular-weight=303.248}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-474

  • common-name:
    • (+)-taxifolin
  • smiles:
    • c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
  • inchi-key:
    • cxqwrcvtcmqvqx-lsdhhaiusa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality