Difference between revisions of "Semiquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == * common-name: ** 3-demethylubiquinol-6 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXYADIPYL-COA ==
+
== Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX ==
 
* common-name:
 
* common-name:
** (3s)-hydroxyadipyl-coa
+
** 3-demethylubiquinol-6
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** oteacgaedcimbs-notshufbsa-i
+
** zqxnznkhqxlvcv-hgjbzhbgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 906.621
+
** 578.874
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2425]]
+
* [[RXN3O-102]]
* [[RXN0-2044]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2425]]
 
* [[RXN0-2044]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
+
{{#set: common-name=3-demethylubiquinol-6}}
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}
+
{{#set: inchi-key=inchikey=zqxnznkhqxlvcv-hgjbzhbgsa-n}}
{{#set: molecular-weight=906.621}}
+
{{#set: molecular-weight=578.874}}

Revision as of 11:18, 15 January 2021

Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX

  • common-name:
    • 3-demethylubiquinol-6
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c
  • inchi-key:
    • zqxnznkhqxlvcv-hgjbzhbgsa-n
  • molecular-weight:
    • 578.874

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality