Difference between revisions of "Semiquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == * common-name: ** 3-demethylubiquinol-6 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
(Created page with "Category:metabolite == Metabolite Semiquinones == * common-name: ** a semiquinone == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compo...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX ==
+
== Metabolite Semiquinones ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-6
+
** a semiquinone
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** zqxnznkhqxlvcv-hgjbzhbgsa-n
 
* molecular-weight:
 
** 578.874
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-102]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[QOR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-6}}
+
{{#set: common-name=a semiquinone}}
{{#set: inchi-key=inchikey=zqxnznkhqxlvcv-hgjbzhbgsa-n}}
 
{{#set: molecular-weight=578.874}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Semiquinones

  • common-name:
    • a semiquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality