Difference between revisions of "Serines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17638 == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite Serines == * common-name: ** serine == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * P...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17638 ==
+
== Metabolite Serines ==
 
* common-name:
 
* common-name:
** 7-hydroxylauroyl-coa
+
** serine
* smiles:
 
** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** rxedusgpuqqzew-xirpngcasa-j
 
* molecular-weight:
 
** 961.807
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12184]]
+
* [[PSERPHOSPHA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-hydroxylauroyl-coa}}
+
{{#set: common-name=serine}}
{{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}}
 
{{#set: molecular-weight=961.807}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Serines

  • common-name:
    • serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality