Difference between revisions of "Soluble-Heteroglycans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_I == * common-name: ** coproporphyrinogen i * smiles: ** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(c...")
(Created page with "Category:metabolite == Metabolite Soluble-Heteroglycans == * common-name: ** a plant soluble heteroglycan == Reaction(s) known to consume the compound == * RXN-14353 =...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COPROPORPHYRINOGEN_I ==
+
== Metabolite Soluble-Heteroglycans ==
 
* common-name:
 
* common-name:
** coproporphyrinogen i
+
** a plant soluble heteroglycan
* smiles:
 
** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
* inchi-key:
 
** wiuggjkhyqignh-uhfffaoysa-j
 
* molecular-weight:
 
** 656.734
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14353]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10642]]
+
* [[RXN-14353]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen i}}
+
{{#set: common-name=a plant soluble heteroglycan}}
{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}
 
{{#set: molecular-weight=656.734}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Soluble-Heteroglycans

  • common-name:
    • a plant soluble heteroglycan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality