Difference between revisions of "Sphingoid-1-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...") |
(Created page with "Category:metabolite == Metabolite Sphingoid-1-phosphates == * common-name: ** a sphingoid 1-phosphate == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
(3 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Sphingoid-1-phosphates == |
* common-name: | * common-name: | ||
− | ** | + | ** a sphingoid 1-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-11376]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a sphingoid 1-phosphate}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Sphingoid-1-phosphates
- common-name:
- a sphingoid 1-phosphate