Difference between revisions of "Sphingoids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ENOL-OXALOACETATE == * common-name: ** enol-oxaloacetate * smiles: ** c([o-])(=o)c(o)=cc(=o)[o-] * inchi-key: ** uwyvpfmhmjibhe-uphrsurjs...") |
(Created page with "Category:metabolite == Metabolite Sphingoids == * common-name: ** a sphingoid base == Reaction(s) known to consume the compound == * RXN-11376 * SPHINGOSINE-N-ACYLTR...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Sphingoids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a sphingoid base |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11376]] |
| + | * [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a sphingoid base}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Sphingoids
- common-name:
- a sphingoid base
