Difference between revisions of "Sphingoids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ENOL-OXALOACETATE == * common-name: ** enol-oxaloacetate * smiles: ** c([o-])(=o)c(o)=cc(=o)[o-] * inchi-key: ** uwyvpfmhmjibhe-uphrsurjs...")
(Created page with "Category:metabolite == Metabolite L-fucose-protein-serine == * common-name: ** a [protein]-3-o-l-fucosyl-l-serine == Reaction(s) known to consume the compound == * 2.4.1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ENOL-OXALOACETATE ==
+
== Metabolite L-fucose-protein-serine ==
 
* common-name:
 
* common-name:
** enol-oxaloacetate
+
** a [protein]-3-o-l-fucosyl-l-serine
* smiles:
 
** c([o-])(=o)c(o)=cc(=o)[o-]
 
* inchi-key:
 
** uwyvpfmhmjibhe-uphrsurjsa-l
 
* molecular-weight:
 
** 130.057
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OXALOACETATE-TAUTOMERASE-RXN]]
+
* [[2.4.1.221-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.221-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=enol-oxaloacetate}}
+
{{#set: common-name=a [protein]-3-o-l-fucosyl-l-serine}}
{{#set: inchi-key=inchikey=uwyvpfmhmjibhe-uphrsurjsa-l}}
 
{{#set: molecular-weight=130.057}}
 

Revision as of 18:56, 14 January 2021

Metabolite L-fucose-protein-serine

  • common-name:
    • a [protein]-3-o-l-fucosyl-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-l-fucosyl-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.