Difference between revisions of "Spliced-tRNA-precursor"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10329 == * common-name: ** α-l-fucopyranose * smiles: ** cc1(oc(c(c(c1o)o)o)o) * inchi-key: ** shzgcjcmobcmkk-sxuwkvjysa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-11665 == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) * inchi-key: ** jfwysggscoobgk-uh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11665 == |
* common-name: | * common-name: | ||
| − | ** | + | ** serotonin o-sulfate |
* smiles: | * smiles: | ||
| − | ** cc1( | + | ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jfwysggscoobgk-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.276 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10777]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=serotonin o-sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.276}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-11665
- common-name:
- serotonin o-sulfate
- smiles:
- c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
- inchi-key:
- jfwysggscoobgk-uhfffaoysa-n
- molecular-weight:
- 256.276
