Difference between revisions of "Spliced-tRNA-precursor"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...") |
(Created page with "Category:metabolite == Metabolite Spliced-tRNA-precursor == * common-name: ** a spliced trna == Reaction(s) known to consume the compound == == Reaction(s) known to produc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Spliced-tRNA-precursor == |
* common-name: | * common-name: | ||
− | ** | + | ** a spliced trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.7.1.160-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a spliced trna}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Spliced-tRNA-precursor
- common-name:
- a spliced trna