Difference between revisions of "SsDNA-RNA-primer-hybrid"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-THYROXINE == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite ssDNA-RNA-primer-hybrid == * common-name: ** an ssdna/rna primer hybrid == Reaction(s) known to consume the compound == == Reaction(s) kn...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-THYROXINE ==
+
== Metabolite ssDNA-RNA-primer-hybrid ==
 
* common-name:
 
* common-name:
** l-thyroxine
+
** an ssdna/rna primer hybrid
* smiles:
 
** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
 
* inchi-key:
 
** xuiikfgfijcvmt-lbprgkrzsa-n
 
* molecular-weight:
 
** 776.874
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10606]]
 
* [[RXN-10608]]
 
* [[RXN-10614]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5021]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine}}
+
{{#set: common-name=an ssdna/rna primer hybrid}}
{{#set: inchi-key=inchikey=xuiikfgfijcvmt-lbprgkrzsa-n}}
 
{{#set: molecular-weight=776.874}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite ssDNA-RNA-primer-hybrid

  • common-name:
    • an ssdna/rna primer hybrid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality