Difference between revisions of "SsDNA-RNA-primer-hybrid"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-THYROXINE == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite ssDNA-RNA-primer-hybrid == * common-name: ** an ssdna/rna primer hybrid == Reaction(s) known to consume the compound == == Reaction(s) kn...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ssDNA-RNA-primer-hybrid == |
* common-name: | * common-name: | ||
− | ** | + | ** an ssdna/rna primer hybrid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-5021]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an ssdna/rna primer hybrid}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ssDNA-RNA-primer-hybrid
- common-name:
- an ssdna/rna primer hybrid