Difference between revisions of "SsRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite ssRNAs == * common-name: ** a single-stranded rna == Reaction(s) known to consume the compound == * 2.7.7.8-RXN == Reaction(s) known...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ssRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a single-stranded rna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.8-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.7.8-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a single-stranded rna}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ssRNAs
- common-name:
- a single-stranded rna
