Difference between revisions of "Stearoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13393 == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=o)c[n+] * inchi-key: ** pfmuccyyaafkth-yfkpbyrvsa-n *...") |
(Created page with "Category:metabolite == Metabolite Stearoyl-ACPs == * common-name: ** a stearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16024 * RXN-16076 * R...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Stearoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a stearoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16024]] |
| + | * [[RXN-16076]] | ||
| + | * [[RXN-9548]] | ||
| + | * [[RXN1G-368]] | ||
| + | * [[RXN3O-5304]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9635]] | ||
| + | * [[RXN3O-5293]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a stearoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Stearoyl-ACPs
- common-name:
- a stearoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a stearoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
