Difference between revisions of "Stearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 10-FORMYL-THF == * common-name: ** 10-formyl-tetrahydrofolate mono-l-glutamate * smiles: ** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc(...")
(Created page with "Category:metabolite == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == * common-name: ** udp-β-l-threo-pentapyranos-4-ulose * smiles: ** c3(oc(op(=o)([o-])op(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 10-FORMYL-THF ==
+
== Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- ==
 
* common-name:
 
* common-name:
** 10-formyl-tetrahydrofolate mono-l-glutamate
+
** udp-β-l-threo-pentapyranos-4-ulose
 
* smiles:
 
* smiles:
** c2([ch](cn(c=o)c1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))nc3(c(=o)nc(n)=nc(n2)=3))
+
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
 
* inchi-key:
 
* inchi-key:
** aufgtpparqzwdo-ypmhnxcesa-l
+
** urjziqltpcjvmw-qnsckltrsa-l
 
* molecular-weight:
 
* molecular-weight:
** 471.429
+
** 532.247
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPAIF]]
+
* [[RXN0-1863]]
* [[FPGFTh]]
 
* [[FTHDF]]
 
* [[MTHFCx]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FPAIF]]
+
* [[RXN0-1863]]
* [[FPGFTh]]
 
* [[FTHFL]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=10-formyl-tetrahydrofolate mono-l-glutamate}}
+
{{#set: common-name=udp-β-l-threo-pentapyranos-4-ulose}}
{{#set: inchi-key=inchikey=aufgtpparqzwdo-ypmhnxcesa-l}}
+
{{#set: inchi-key=inchikey=urjziqltpcjvmw-qnsckltrsa-l}}
{{#set: molecular-weight=471.429}}
+
{{#set: molecular-weight=532.247}}

Revision as of 15:26, 5 January 2021

Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-

  • common-name:
    • udp-β-l-threo-pentapyranos-4-ulose
  • smiles:
    • c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
  • inchi-key:
    • urjziqltpcjvmw-qnsckltrsa-l
  • molecular-weight:
    • 532.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality