Difference between revisions of "Stearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12237 == * transcription-direction: ** negative * right-end-position: ** 196218 * left-end-position: ** 175413 * centisome-position: ** 48.70608...")
(Created page with "Category:metabolite == Metabolite RIBOSE-1-ARSENATE == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) * inchi-key: ** ryjjomqpaa...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12237 ==
+
== Metabolite RIBOSE-1-ARSENATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** ribose-1-arsenate
−
* right-end-position:
+
* smiles:
−
** 196218
+
** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
−
* left-end-position:
+
* inchi-key:
−
** 175413
+
** ryjjomqpaaufbf-txicztdvsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 48.70608   
+
** 272.043
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-7001]]
−
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=ribose-1-arsenate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}}
−
* [[LYSINE--TRNA-LIGASE-RXN]]
+
{{#set: molecular-weight=272.043}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[TRNA-CHARGING-PWY]]
 
−
** '''21''' reactions found over '''21''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=196218}}
 
−
{{#set: left-end-position=175413}}
 
−
{{#set: centisome-position=48.70608    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:32, 18 December 2020

Metabolite RIBOSE-1-ARSENATE

  • common-name:
    • ribose-1-arsenate
  • smiles:
    • c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
  • inchi-key:
    • ryjjomqpaaufbf-txicztdvsa-l
  • molecular-weight:
    • 272.043

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Stearoyl-ACPs&oldid=46348"