Difference between revisions of "Sugar-1-Phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == * common-name: ** 3-demethylubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite Sugar-1-Phosphate == * common-name: ** a sugar 1-phosphate == Reaction(s) known to consume the compound == * 2.7.7.64-RXN == Reaction...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ ==
+
== Metabolite Sugar-1-Phosphate ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-8
+
** a sugar 1-phosphate
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
** qurlimhpcrkmjp-wdxiliiosa-n
 
* molecular-weight:
 
** 715.11
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHHB-METHYLTRANSFER-RXN]]
+
* [[2.7.7.64-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.7.64-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-8}}
+
{{#set: common-name=a sugar 1-phosphate}}
{{#set: inchi-key=inchikey=qurlimhpcrkmjp-wdxiliiosa-n}}
 
{{#set: molecular-weight=715.11}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Sugar-1-Phosphate

  • common-name:
    • a sugar 1-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality