Difference between revisions of "Sugar-1-Phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
(Created page with "Category:metabolite == Metabolite Sugar-1-Phosphate == * common-name: ** a sugar 1-phosphate == Reaction(s) known to consume the compound == * 2.7.7.64-RXN == Reaction...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Sugar-1-Phosphate == |
* common-name: | * common-name: | ||
− | ** | + | ** a sugar 1-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.7.64-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.7.64-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a sugar 1-phosphate}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Sugar-1-Phosphate
- common-name:
- a sugar 1-phosphate