Difference between revisions of "Sugar-1-Phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-15056 == * common-name: ** (2z)-2-aminobut-2-enoate * smiles: ** cc=c(n)c(=o)[o-] * inchi-key: ** pawsvpvnixfkos-ihwypqmzsa-m * molec...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15056 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z)-2-aminobut-2-enoate |
* smiles: | * smiles: | ||
− | ** cc | + | ** cc=c(n)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pawsvpvnixfkos-ihwypqmzsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 100.097 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15122]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14048]] |
− | * [[RXN- | + | * [[RXN-14049]] |
− | * [[ | + | * [[RXN-15122]] |
+ | * [[RXN-15148]] | ||
+ | * [[RXN-15149]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z)-2-aminobut-2-enoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pawsvpvnixfkos-ihwypqmzsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=100.097}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-15056
- common-name:
- (2z)-2-aminobut-2-enoate
- smiles:
- cc=c(n)c(=o)[o-]
- inchi-key:
- pawsvpvnixfkos-ihwypqmzsa-m
- molecular-weight:
- 100.097