Difference between revisions of "Sugar-Phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite Sugar-Phosphate == * common-name: ** a sugar phosphate == Reaction(s) known to consume the compound == * SUGAR-PHOSPHATASE-RXN == Rea...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9858 ==
+
== Metabolite Sugar-Phosphate ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** a sugar phosphate
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** wegxyvfdoluulo-tuumqracsa-n
 
* molecular-weight:
 
** 616.966
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
+
* [[SUGAR-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a sugar phosphate}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
 
{{#set: molecular-weight=616.966}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Sugar-Phosphate

  • common-name:
    • a sugar phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality