Difference between revisions of "Sugar-Phosphate"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10368 == * transcription-direction: ** positive * right-end-position: ** 586013 * left-end-position: ** 585474 * centisome-position: ** 72.36722...") |
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9858 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol |
| − | + | * smiles: | |
| − | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c | |
| − | + | * inchi-key: | |
| − | + | ** wegxyvfdoluulo-tuumqracsa-n | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 616.966 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-9227]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}} | |
| − | ** | + | {{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}} |
| − | * | + | {{#set: molecular-weight=616.966}} |
| − | |||
| − | ** | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-9858
- common-name:
- 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
- inchi-key:
- wegxyvfdoluulo-tuumqracsa-n
- molecular-weight:
- 616.966
