Difference between revisions of "Sugar-Phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite CPD-239 == * common-name: ** cysteamine * smiles: ** c(cs)[n+] * inchi-key: ** ufulayfcsouiov-uhfffaoysa-o * molecular-weight: ** 78.152...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9858 ==
+
== Metabolite CPD-239 ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** cysteamine
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
+
** c(cs)[n+]
 
* inchi-key:
 
* inchi-key:
** wegxyvfdoluulo-tuumqracsa-n
+
** ufulayfcsouiov-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 616.966
+
** 78.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
+
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=cysteamine}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
+
{{#set: inchi-key=inchikey=ufulayfcsouiov-uhfffaoysa-o}}
{{#set: molecular-weight=616.966}}
+
{{#set: molecular-weight=78.152}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-239

  • common-name:
    • cysteamine
  • smiles:
    • c(cs)[n+]
  • inchi-key:
    • ufulayfcsouiov-uhfffaoysa-o
  • molecular-weight:
    • 78.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality