Difference between revisions of "Sugar-alcohols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-Lactams == * common-name: ** a β-lactam == Reaction(s) known to consume the compound == * BETA-LACTAMASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) * inchi-key: ** mvawjsidnickh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N-ACETYL-SEROTONIN == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-serotonin |
+ | * smiles: | ||
+ | ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) | ||
+ | * inchi-key: | ||
+ | ** mvawjsidnickhf-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 218.255 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11059]] |
+ | * [[RXN-11060]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11057]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin}} |
+ | {{#set: inchi-key=inchikey=mvawjsidnickhf-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=218.255}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite N-ACETYL-SEROTONIN
- common-name:
- n-acetyl-serotonin
- smiles:
- cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
- inchi-key:
- mvawjsidnickhf-uhfffaoysa-n
- molecular-weight:
- 218.255