Difference between revisions of "Sugar-alcohols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) * inchi-key: ** mvawjsidnickh...") |
(Created page with "Category:metabolite == Metabolite Sugar-alcohols == * common-name: ** a sugar alcohol == Reaction(s) known to consume the compound == * ALDEHYDE-REDUCTASE-RXN * RXN-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Sugar-alcohols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a sugar alcohol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[ALDEHYDE-REDUCTASE-RXN]] |
| − | * [[RXN- | + | * [[RXN-9926]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ALDEHYDE-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a sugar alcohol}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Sugar-alcohols
- common-name:
- a sugar alcohol
