Difference between revisions of "Sulfhydryls"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ISOBUTYRYL-COA == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
(Created page with "Category:metabolite == Metabolite 2-LYSOPHOSPHATIDYLETHANOLAMINES == * common-name: ** a 1-acyl 2-lyso-phosphatidylethanolamine == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ISOBUTYRYL-COA ==
+
== Metabolite 2-LYSOPHOSPHATIDYLETHANOLAMINES ==
 
* common-name:
 
* common-name:
** isobutanoyl-coa
+
** a 1-acyl 2-lyso-phosphatidylethanolamine
* smiles:
 
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
** aewhywspvrzhct-ndzskpawsa-j
 
* molecular-weight:
 
** 833.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.168-RXN]]
 
* [[MCDH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.25-RXN]]
+
* [[RXN0-6725]]
* [[2.3.1.168-RXN]]
 
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isobutanoyl-coa}}
+
{{#set: common-name=a 1-acyl 2-lyso-phosphatidylethanolamine}}
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
 
{{#set: molecular-weight=833.593}}
 

Revision as of 18:58, 14 January 2021

Metabolite 2-LYSOPHOSPHATIDYLETHANOLAMINES

  • common-name:
    • a 1-acyl 2-lyso-phosphatidylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality