Difference between revisions of "Sulfhydryls"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite Sulfhydryls == * common-name: ** r'c(r)sh == Reaction(s) known to consume the compound == * THIOL-OXIDASE-RXN == Reaction(s) known to...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Sulfhydryls == |
* common-name: | * common-name: | ||
| − | ** | + | ** r'c(r)sh |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[THIOL-OXIDASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=r'c(r)sh}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Sulfhydryls
- common-name:
- r'c(r)sh
