Difference between revisions of "Sulfhydryls"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ISOBUTYRYL-COA == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
(Created page with "Category:metabolite == Metabolite Sulfhydryls == * common-name: ** r'c(r)sh == Reaction(s) known to consume the compound == * THIOL-OXIDASE-RXN == Reaction(s) known to...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ISOBUTYRYL-COA ==
+
== Metabolite Sulfhydryls ==
 
* common-name:
 
* common-name:
** isobutanoyl-coa
+
** r'c(r)sh
* smiles:
 
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
** aewhywspvrzhct-ndzskpawsa-j
 
* molecular-weight:
 
** 833.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.168-RXN]]
+
* [[THIOL-OXIDASE-RXN]]
* [[MCDH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.25-RXN]]
 
* [[2.3.1.168-RXN]]
 
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isobutanoyl-coa}}
+
{{#set: common-name=r'c(r)sh}}
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
 
{{#set: molecular-weight=833.593}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Sulfhydryls

  • common-name:
    • r'c(r)sh

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality