Difference between revisions of "Sulfhydryls"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17925 RXN-17925] == * direction: ** left-to-right == Reaction formula == * 1 ATP[c] '''+'''...")
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17925 RXN-17925] ==
+
== Metabolite CPD1G-120 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** deacetylmycothiol
−
== Reaction formula ==
+
* smiles:
−
* 1 [[ATP]][c] '''+''' 1 [[RNA-Ligase-L-lysine]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[RNA-Ligase-L-lysine-adenylate]][c]
+
** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ03634]]
+
** zgxscmbzzvxwgf-bseffjthsa-o
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 445.461
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN1G-121]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=deacetylmycothiol}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}}
−
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=445.461}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD1G-120

  • common-name:
    • deacetylmycothiol
  • smiles:
    • c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
  • inchi-key:
    • zgxscmbzzvxwgf-bseffjthsa-o
  • molecular-weight:
    • 445.461

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Sulfhydryls&oldid=48267"