Difference between revisions of "Sulfhydryls"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-160 == * common-name: ** a phosphatidyl-n-dimethylethanolamine == Reaction(s) known to consume the compound == * RXN4FS-2 == Reac...")
(Created page with "Category:metabolite == Metabolite ISOBUTYRYL-COA == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-160 ==
+
== Metabolite ISOBUTYRYL-COA ==
 
* common-name:
 
* common-name:
** a phosphatidyl-n-dimethylethanolamine
+
** isobutanoyl-coa
 +
* smiles:
 +
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 +
* inchi-key:
 +
** aewhywspvrzhct-ndzskpawsa-j
 +
* molecular-weight:
 +
** 833.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN4FS-2]]
+
* [[2.3.1.168-RXN]]
 +
* [[MCDH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.71-RXN]]
+
* [[1.2.1.25-RXN]]
 +
* [[2.3.1.168-RXN]]
 +
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a phosphatidyl-n-dimethylethanolamine}}
+
{{#set: common-name=isobutanoyl-coa}}
 +
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
 +
{{#set: molecular-weight=833.593}}

Revision as of 13:12, 14 January 2021

Metabolite ISOBUTYRYL-COA

  • common-name:
    • isobutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • aewhywspvrzhct-ndzskpawsa-j
  • molecular-weight:
    • 833.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality