Difference between revisions of "Sulfur-Carrier-Proteins-ThiI"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...") |
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-667 == |
* common-name: | * common-name: | ||
| − | ** | + | ** o-acetyl-l-homoserine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(occc(c([o-])=o)[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fcxzbwsiaggpcb-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 161.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACETYLHOMOSER-CYS-RXN]] |
| + | * [[ACHMSSELCYSL]] | ||
| + | * [[ACHMSSELCYSLh]] | ||
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACETYLHOMOSER-CYS-RXN]] |
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-acetyl-l-homoserine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fcxzbwsiaggpcb-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=161.157}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite CPD-667
- common-name:
- o-acetyl-l-homoserine
- smiles:
- cc(occc(c([o-])=o)[n+])=o
- inchi-key:
- fcxzbwsiaggpcb-yfkpbyrvsa-n
- molecular-weight:
- 161.157
