Difference between revisions of "Sulfur-Carrier-Proteins-ThiI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...")
(Created page with "Category:metabolite == Metabolite Sulfur-Carrier-Proteins-ThiI == * common-name: ** a [thii sulfur-carrier protein]-l-cysteine == Reaction(s) known to consume the compound...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRO-NEO-PTERIN ==
+
== Metabolite Sulfur-Carrier-Proteins-ThiI ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin
+
** a [thii sulfur-carrier protein]-l-cysteine
* smiles:
 
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
 
* inchi-key:
 
** yqifamynggotfb-xinawcovsa-n
 
* molecular-weight:
 
** 255.233
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2NEOPTERINALDOL-RXN]]
+
* [[RXN-14382]]
 +
* [[RXN-9787]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[RXN-9787]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin}}
+
{{#set: common-name=a [thii sulfur-carrier protein]-l-cysteine}}
{{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}}
 
{{#set: molecular-weight=255.233}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Sulfur-Carrier-Proteins-ThiI

  • common-name:
    • a [thii sulfur-carrier protein]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [thii sulfur-carrier protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.