Difference between revisions of "Sulfurated-Sulfur-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3187 == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2)) * inchi-key: ** boqrppfuushfgw-snvbaglbsa...") |
(Created page with "Category:metabolite == Metabolite CPD-14766 == * common-name: ** 2-hydroxyhexadecanal * smiles: ** ccccccccccccccc(o)[ch]=o * inchi-key: ** bkbdvqvdrvgxkt-uhfffaoysa-n * m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-14766 == |
* common-name: | * common-name: | ||
− | ** 2 | + | ** 2-hydroxyhexadecanal |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccccccccccc(o)[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bkbdvqvdrvgxkt-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 256.428 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13729]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2 | + | {{#set: common-name=2-hydroxyhexadecanal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bkbdvqvdrvgxkt-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.428}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-14766
- common-name:
- 2-hydroxyhexadecanal
- smiles:
- ccccccccccccccc(o)[ch]=o
- inchi-key:
- bkbdvqvdrvgxkt-uhfffaoysa-n
- molecular-weight:
- 256.428