Difference between revisions of "Sulfurylated-ThiI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE == * common-name: ** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite Sulfurylated-ThiI == * common-name: ** a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine == Reaction(s) known to consume the compound...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE ==
+
== Metabolite Sulfurylated-ThiI ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine
+
** a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** xxkfqtjojzelmd-jicbsjgisa-n
 
* molecular-weight:
 
** 778.06
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9787]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8325]]
+
* [[RXN-14382]]
* [[RXN-8331]]
+
* [[RXN-9787]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine}}
+
{{#set: common-name=a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine}}
{{#set: inchi-key=inchikey=xxkfqtjojzelmd-jicbsjgisa-n}}
 
{{#set: molecular-weight=778.06}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Sulfurylated-ThiI

  • common-name:
    • a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.