Difference between revisions of "Sulfurylated-ThiI"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezvlhj...") |
(Created page with "Category:metabolite == Metabolite Sulfurylated-ThiI == * common-name: ** a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine == Reaction(s) known to consume the compound...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Sulfurylated-ThiI == |
* common-name: | * common-name: | ||
− | ** | + | ** a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-9787]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14382]] |
− | * [[RXN- | + | * [[RXN-9787]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Sulfurylated-ThiI
- common-name:
- a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.