Difference between revisions of "T2-C4-DECADIENYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8351 RXN-8351] == * direction: ** left-to-right * common-name: ** molybdenum cofactor sulfurtra...")
(Created page with "Category:metabolite == Metabolite T2-C4-DECADIENYL-COA == * common-name: ** trans-δ2, cis-δ4-decadienoyl-coa * smiles: ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8351 RXN-8351] ==
+
== Metabolite T2-C4-DECADIENYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** molybdenum cofactor sulfurtransferase
+
** trans-δ2, cis-δ4-decadienoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.8.1.9 ec-2.8.1.9]
+
** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8123]][c] '''+''' 1 [[CYS]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[Acceptor]][c] '''+''' 1 [[CPD-8124]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[WATER]][c]
+
** fasakylwsrdqoh-imvfqkdnsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20867]]
+
** 913.722
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DIENOYLCOAREDUCT-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-5963]], thio-molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5963 PWY-5963]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
{{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=913.722}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42637 42637]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=molybdenum cofactor sulfurtransferase}}
 
−
{{#set: ec-number=ec-2.8.1.9}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite T2-C4-DECADIENYL-COA

  • common-name:
    • trans-δ2, cis-δ4-decadienoyl-coa
  • smiles:
    • cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fasakylwsrdqoh-imvfqkdnsa-j
  • molecular-weight:
    • 913.722

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=T2-C4-DECADIENYL-COA&oldid=138895"