Difference between revisions of "T2-C4-DECADIENYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5881 == * common-name: ** (6r)-4a-hydroxy-tetrahydrobiopterin * smiles: ** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite T2-C4-DECADIENYL-COA == * common-name: ** trans-δ2, cis-δ4-decadienoyl-coa * smiles: ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite T2-C4-DECADIENYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-δ2, cis-δ4-decadienoyl-coa |
* smiles: | * smiles: | ||
| − | ** cc(o)c(o) | + | ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fasakylwsrdqoh-imvfqkdnsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 913.722 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIENOYLCOAREDUCT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=913.722}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite T2-C4-DECADIENYL-COA
- common-name:
- trans-δ2, cis-δ4-decadienoyl-coa
- smiles:
- cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- fasakylwsrdqoh-imvfqkdnsa-j
- molecular-weight:
- 913.722
