Difference between revisions of "T2-C4-DECADIENYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7015 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=...")
(Created page with "Category:metabolite == Metabolite T2-C4-DECADIENYL-COA == * common-name: ** trans-δ2, cis-δ4-decadienoyl-coa * smiles: ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7015 ==
+
== Metabolite T2-C4-DECADIENYL-COA ==
 +
* common-name:
 +
** trans-δ2, cis-δ4-decadienoyl-coa
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* common-name:
+
* inchi-key:
** 71-hydroxychlorophyllide a
+
** fasakylwsrdqoh-imvfqkdnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 628.966
+
** 913.722
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7677]]
+
* [[DIENOYLCOAREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7676]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=71-hydroxychlorophyllide a}}
+
{{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}}
{{#set: molecular-weight=628.966}}
+
{{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}}
 +
{{#set: molecular-weight=913.722}}

Latest revision as of 11:16, 18 March 2021

Metabolite T2-C4-DECADIENYL-COA

  • common-name:
    • trans-δ2, cis-δ4-decadienoyl-coa
  • smiles:
    • cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fasakylwsrdqoh-imvfqkdnsa-j
  • molecular-weight:
    • 913.722

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality