Difference between revisions of "T2-C4-DECADIENYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7015 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=...") |
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == |
| + | * common-name: | ||
| + | ** α-glucose 1,6-bisphosphate | ||
* smiles: | * smiles: | ||
| − | ** c | + | ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** rwhozgraxywrnx-vfuothlcsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16998]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16997]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-glucose 1,6-bisphosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}} |
| + | {{#set: molecular-weight=336.085}} | ||
Revision as of 13:11, 14 January 2021
Contents
Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE
- common-name:
- α-glucose 1,6-bisphosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
- inchi-key:
- rwhozgraxywrnx-vfuothlcsa-j
- molecular-weight:
- 336.085
