Difference between revisions of "T2-DECENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558] == * direction: ** left-to-right * common-name: ** crotonyl-coa reductase (nad...")
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558] ==
+
== Metabolite T2-DECENOYL-COA ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** crotonyl-coa reductase (nad+)
+
** (2e)-dec-2-enoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.1.44 ec-1.3.1.44]
+
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CROTONYL-COA]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[BUTYRYL-COA]][c] '''+''' 1 [[NAD]][c]
+
** mgnbgcrqqfmnbm-yjhhllfwsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ07241]]
+
** 915.738
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ECOAH4h]]
== Pathway(s)  ==
+
* [[RXN-13616]]
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
* [[RXN-14805]]
** '''9''' reactions found over '''11''' reactions in the full pathway
+
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
* [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
+
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
** '''5''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[DIENOYLCOAREDUCT-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[ECOAH4h]]
== External links  ==
+
* [[RXN-13615]]
* RHEA:
+
* [[RXN-14805]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=46962 46962]
+
== Reaction(s) of unknown directionality ==
* LIGAND-RXN:
+
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
** [http://www.genome.jp/dbget-bin/www_bget?R01171 R01171]
+
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=915.738}}
{{#set: common-name=crotonyl-coa reductase (nad+)}}
 
{{#set: ec-number=ec-1.3.1.44}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite T2-DECENOYL-COA

  • common-name:
    • (2e)-dec-2-enoyl-coa
  • smiles:
    • cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mgnbgcrqqfmnbm-yjhhllfwsa-j
  • molecular-weight:
    • 915.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality