Difference between revisions of "T2-DECENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12959 RXN-12959] == * direction: ** left-to-right * common-name: ** diacylglycerol kinase (ctp)...")
 
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12959 RXN-12959] ==
+
== Metabolite T2-DECENOYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** diacylglycerol kinase (ctp)
+
** (2e)-dec-2-enoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.174 ec-2.7.1.174]
+
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CTP]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[CDP]][c] '''+''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c]
+
** mgnbgcrqqfmnbm-yjhhllfwsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ12057]]
+
** 915.738
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ECOAH4h]]
−
* Gene: [[SJ12148]]
+
* [[RXN-13616]]
−
** Category: [[annotation]]
+
* [[RXN-14805]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
−
== Pathway(s)  ==
+
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
−
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
+
== Reaction(s) known to produce the compound ==
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
* [[DIENOYLCOAREDUCT-RXN]]
−
== Reconstruction information  ==
+
* [[ECOAH4h]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13615]]
−
== External links  ==
+
* [[RXN-14805]]
−
* LIGAND-RXN:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.genome.jp/dbget-bin/www_bget?R09944 R09944]
+
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25951 25951]
+
{{#set: molecular-weight=915.738}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=diacylglycerol kinase (ctp)}}
 
−
{{#set: ec-number=ec-2.7.1.174}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite T2-DECENOYL-COA

  • common-name:
    • (2e)-dec-2-enoyl-coa
  • smiles:
    • cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mgnbgcrqqfmnbm-yjhhllfwsa-j
  • molecular-weight:
    • 915.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=T2-DECENOYL-COA&oldid=139022"