Difference between revisions of "T2-DECENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558] == * direction: ** left-to-right * common-name: ** crotonyl-coa reductase (nad...")
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * smiles: ** cc(=o)nc1(c(n)oc(co)c(o)c(o)1) * inch...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558] ==
+
== Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** crotonyl-coa reductase (nad+)
+
** n-acetyl-β-glucosaminylamine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.44 ec-1.3.1.44]
+
** cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CROTONYL-COA]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[BUTYRYL-COA]][c] '''+''' 1 [[NAD]][c]
+
** mcgxocxffnkasf-fmdgeedcsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07241]]
+
** 220.225
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[3.5.1.26-RXN]]
−
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
* [[3.5.1.52-RXN]]
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
+
{{#set: common-name=n-acetyl-β-glucosaminylamine}}
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=220.225}}
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=46962 46962]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01171 R01171]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=crotonyl-coa reductase (nad+)}}
 
−
{{#set: ec-number=ec-1.3.1.44}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:36, 18 December 2020

Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE

  • common-name:
    • n-acetyl-β-glucosaminylamine
  • smiles:
    • cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
  • inchi-key:
    • mcgxocxffnkasf-fmdgeedcsa-n
  • molecular-weight:
    • 220.225

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=T2-DECENOYL-COA&oldid=47838"