Difference between revisions of "T2-DECENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9857 == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9857 ==
+
== Metabolite T2-DECENOYL-COA ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
+
** (2e)-dec-2-enoyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
+
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ywvpprxiddchcq-cuhbluqcsa-n
+
** mgnbgcrqqfmnbm-yjhhllfwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 600.966
+
** 915.738
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH4h]]
 +
* [[RXN-13616]]
 +
* [[RXN-14805]]
 +
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 +
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9225]]
+
* [[DIENOYLCOAREDUCT-RXN]]
 +
* [[ECOAH4h]]
 +
* [[RXN-13615]]
 +
* [[RXN-14805]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
+
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
+
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
{{#set: molecular-weight=600.966}}
+
{{#set: molecular-weight=915.738}}

Latest revision as of 11:16, 18 March 2021

Metabolite T2-DECENOYL-COA

  • common-name:
    • (2e)-dec-2-enoyl-coa
  • smiles:
    • cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mgnbgcrqqfmnbm-yjhhllfwsa-j
  • molecular-weight:
    • 915.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality