Difference between revisions of "TAGATOSE-1-6-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00636 == * transcription-direction: ** positive * right-end-position: ** 130047 * left-end-position: ** 123839 * centisome-position: ** 75.280235...") |
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite TAGATOSE-1-6-DIPHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** d-tagatofuranose 1,6-bisphosphate |
− | + | * smiles: | |
− | * | + | ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o) |
− | + | * inchi-key: | |
− | ** | + | ** rnbgygvwrkecfj-oexcpvawsa-j |
− | + | * molecular-weight: | |
− | + | ** 336.085 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[TAGAALDOL-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[TAGAKIN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=d-tagatofuranose 1,6-bisphosphate}} | |
− | * | + | {{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}} |
− | + | {{#set: molecular-weight=336.085}} | |
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite TAGATOSE-1-6-DIPHOSPHATE
- common-name:
- d-tagatofuranose 1,6-bisphosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
- inchi-key:
- rnbgygvwrkecfj-oexcpvawsa-j
- molecular-weight:
- 336.085