Difference between revisions of "TAGATOSE-1-6-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite mRNA-Fragments == * common-name: ** an mrna fragment == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite mRNA-Fragments ==
+
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** an mrna fragment
+
** d-tagatofuranose 1,6-bisphosphate
 +
* smiles:
 +
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
 +
* inchi-key:
 +
** rnbgygvwrkecfj-oexcpvawsa-j
 +
* molecular-weight:
 +
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TAGAALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.3-RXN]]
+
* [[TAGAKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an mrna fragment}}
+
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
 +
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
 +
{{#set: molecular-weight=336.085}}

Latest revision as of 11:13, 18 March 2021

Metabolite TAGATOSE-1-6-DIPHOSPHATE

  • common-name:
    • d-tagatofuranose 1,6-bisphosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
  • inchi-key:
    • rnbgygvwrkecfj-oexcpvawsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality