Difference between revisions of "TAGATOSE-6-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7Z-hexadec-7-enoyl-ACPs == * common-name: ** a (7z)-hexadec-7-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16625...") |
(Created page with "Category:metabolite == Metabolite TAGATOSE-6-PHOSPHATE == * common-name: ** d-tagatofuranose 6-phosphate * smiles: ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o * inchi-key:...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TAGATOSE-6-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-tagatofuranose 6-phosphate |
| + | * smiles: | ||
| + | ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o | ||
| + | * inchi-key: | ||
| + | ** bgwgxpapygqalx-oexcpvawsa-l | ||
| + | * molecular-weight: | ||
| + | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[TAGAKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-tagatofuranose 6-phosphate}} |
| + | {{#set: inchi-key=inchikey=bgwgxpapygqalx-oexcpvawsa-l}} | ||
| + | {{#set: molecular-weight=258.121}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite TAGATOSE-6-PHOSPHATE
- common-name:
- d-tagatofuranose 6-phosphate
- smiles:
- c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o
- inchi-key:
- bgwgxpapygqalx-oexcpvawsa-l
- molecular-weight:
- 258.121
