Difference between revisions of "TAGATOSE-6-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.8-RXN 3.6.3.8-RXN] == * direction: ** left-to-right * common-name: ** calcium-transporting at...")
(Created page with "Category:metabolite == Metabolite TAGATOSE-6-PHOSPHATE == * common-name: ** d-tagatofuranose 6-phosphate * smiles: ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o * inchi-key:...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.8-RXN 3.6.3.8-RXN] ==
+
== Metabolite TAGATOSE-6-PHOSPHATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** calcium-transporting atpase
+
** d-tagatofuranose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.6.3.8 ec-3.6.3.8]
+
** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][e] '''+''' 1 [[CA+2]][e] '''+''' 1 [[WATER]][e] '''=>''' 1 [[ADP]][e] '''+''' 1 [[CA+2]][c] '''+''' 1 [[PROTON]][e] '''+''' 1 [[Pi]][e]
+
** bgwgxpapygqalx-oexcpvawsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 258.121
−
* Gene: [[SJ17633]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[TAGAKIN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ07343]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=d-tagatofuranose 6-phosphate}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=bgwgxpapygqalx-oexcpvawsa-l}}
−
* Gene: [[SJ16025]]
+
{{#set: molecular-weight=258.121}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ15533]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ03775]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ04245]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ18962]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ18687]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ00675]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ07344]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=calcium-transporting atpase}}
 
−
{{#set: ec-number=ec-3.6.3.8}}
 
−
{{#set: nb gene associated=10}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite TAGATOSE-6-PHOSPHATE

  • common-name:
    • d-tagatofuranose 6-phosphate
  • smiles:
    • c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o
  • inchi-key:
    • bgwgxpapygqalx-oexcpvawsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TAGATOSE-6-PHOSPHATE&oldid=139091"