|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BADH-RXN BADH-RXN] == | + | == Metabolite TAGATOSE-6-PHOSPHATE == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** betaine-aldehyde dehydrogenase | + | ** d-tagatofuranose 6-phosphate |
| − | ** betaine aldehyde dehydrogenase
| + | * smiles: |
| − | * ec-number: | + | ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o |
| − | ** [http://enzyme.expasy.org/EC/1.2.1.8 ec-1.2.1.8] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** bgwgxpapygqalx-oexcpvawsa-l |
| − | * 1 [[BETAINE_ALDEHYDE]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[BETAINE]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 258.121 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ00435]]
| + | * [[TAGAKIN-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=d-tagatofuranose 6-phosphate}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=bgwgxpapygqalx-oexcpvawsa-l}} |
| − | * Gene: [[SJ11330]]
| + | {{#set: molecular-weight=258.121}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ22552]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ11331]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ09287]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06047]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ05897]] | |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY1F-353]], glycine betaine biosynthesis III (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-353 PWY1F-353] | |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[BETSYN-PWY]], glycine betaine biosynthesis I (Gram-negative bacteria): [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[CHOLINE-BETAINE-ANA-PWY]], choline degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-BETAINE-ANA-PWY CHOLINE-BETAINE-ANA-PWY]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-3722]], glycine betaine biosynthesis II (Gram-positive bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3722 PWY-3722]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7494]], choline degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7494 PWY-7494]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30070 30070]
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15305 15305]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02565 R02565]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P17202 P17202]
| |
| − | ** [http://www.uniprot.org/uniprot/P17445 P17445]
| |
| − | ** [http://www.uniprot.org/uniprot/P28237 P28237]
| |
| − | ** [http://www.uniprot.org/uniprot/P42757 P42757]
| |
| − | ** [http://www.uniprot.org/uniprot/Q40024 Q40024]
| |
| − | ** [http://www.uniprot.org/uniprot/O24174 O24174]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43828 Q43828]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43829 Q43829]
| |
| − | ** [http://www.uniprot.org/uniprot/O22477 O22477]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=betaine-aldehyde dehydrogenase|betaine aldehyde dehydrogenase}} | |
| − | {{#set: ec-number=ec-1.2.1.8}} | |
| − | {{#set: nb gene associated=7}} | |
| − | {{#set: nb pathway associated=5}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
