Difference between revisions of "TAGATOSE-6-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HG0 == * common-name: ** hg0 * smiles: ** [hg] * inchi-key: ** qshddoujbyecft-uhfffaoysa-n * molecular-weight: ** 200.59 == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-18 == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18 == |
* common-name: | * common-name: | ||
− | ** | + | ** linoleoyl-coa |
* smiles: | * smiles: | ||
− | ** [ | + | ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yecllimzhnyfck-rrnjgntnsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1025.937 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.14.19.3-RXN]] | ||
+ | * [[FACOAE182]] | ||
+ | * [[LINOLEOYL-RXN]] | ||
+ | * [[RXN-16094]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[LNLCCOAL]] |
+ | * [[RXN-16045]] | ||
+ | * [[RXN-9601]] | ||
+ | * [[RXN-9673]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=linoleoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1025.937}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-18
- common-name:
- linoleoyl-coa
- smiles:
- cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- yecllimzhnyfck-rrnjgntnsa-j
- molecular-weight:
- 1025.937