Difference between revisions of "TCA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc...")
 
(Created page with "Category:pathway == Pathway TCA == * taxonomic-range: ** tax-2 ** tax-2157 * common-name: ** tca cycle i (prokaryotic) == Reaction(s) found == * 2OXOGLUTARATEDEH-RXN *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
+
== Pathway TCA ==
 +
* taxonomic-range:
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
** 4'-apo-β-carotenal
+
** tca cycle i (prokaryotic)
* smiles:
+
== Reaction(s) found ==
** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
+
* [[2OXOGLUTARATEDEH-RXN]]
* inchi-key:
+
* [[ACONITATEDEHYDR-RXN]]
** ftqsfezuhzhoat-brzoagjpsa-n
+
* [[ACONITATEHYDR-RXN]]
* molecular-weight:
+
* [[CITSYN-RXN]]
** 482.748
+
* [[FUMHYDR-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[ISOCITDEH-RXN]]
== Reaction(s) known to produce the compound ==
+
* [[MALATE-DEH-RXN]]
* [[RXN-11989]]
+
* [[RXN-14971]]
== Reaction(s) of unknown directionality ==
+
* [[SUCCCOASYN-RXN]]
{{#set: common-name=4'-apo-β-carotenal}}
+
== Reaction(s) not found ==
{{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}}
+
* [NoneMALATE-DEHYDROGENASE-ACCEPTOR-RXN MALATE-DEHYDROGENASE-ACCEPTOR-RXN]
{{#set: molecular-weight=482.748}}
+
{{#set: taxonomic-range=tax-2|tax-2157}}
 +
{{#set: common-name=tca cycle i (prokaryotic)}}
 +
{{#set: nb reaction found=9}}
 +
{{#set: completion rate=0.9}}
 +
{{#set: nb total reaction=10}}

Latest revision as of 10:58, 18 March 2021

Pathway TCA

  • taxonomic-range:
    • tax-2
    • tax-2157
  • common-name:
    • tca cycle i (prokaryotic)

Reaction(s) found

Reaction(s) not found

  • [NoneMALATE-DEHYDROGENASE-ACCEPTOR-RXN MALATE-DEHYDROGENASE-ACCEPTOR-RXN]