Difference between revisions of "TCA"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
+== Pathway PWY-6316 ==
+* taxonomic-range:
+** tax-23216
 * common-name:
-** 6-trans-tridecenoyl-coa
+** aromatic polyketides biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** uuivzebypbpkll-hmxwsvnbsa-j
+* [NoneRXN-7822 RXN-7822]
-* molecular-weight:
+{{#set: taxonomic-range=tax-23216}}
-** 957.819
+{{#set: common-name=aromatic polyketides biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-14785]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=6-trans-tridecenoyl-coa}}
-{{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}}
-{{#set: molecular-weight=957.819}}