Difference between revisions of "TDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Methylated-DNA-Bases == * common-name: ** a methylated nucleobase within dna == Reaction(s) known to consume the compound == * RXN-1235...")
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: ** ujlxyodchael...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Methylated-DNA-Bases ==
+
== Metabolite TDP ==
 
* common-name:
 
* common-name:
** a methylated nucleobase within dna
+
** dtdp
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2))
 +
* inchi-key:
 +
** ujlxyodchaelly-xlpzgreqsa-k
 +
* molecular-weight:
 +
** 399.167
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12353]]
+
* [[DTDPKIN-RXN]]
 +
* [[RXN-14213]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DTMPKI-RXN]]
 +
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a methylated nucleobase within dna}}
+
{{#set: common-name=dtdp}}
 +
{{#set: inchi-key=inchikey=ujlxyodchaelly-xlpzgreqsa-k}}
 +
{{#set: molecular-weight=399.167}}

Latest revision as of 11:13, 18 March 2021

Metabolite TDP

  • common-name:
    • dtdp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2))
  • inchi-key:
    • ujlxyodchaelly-xlpzgreqsa-k
  • molecular-weight:
    • 399.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality